C28H32F3NO5S — CID 91425434
[(8S,10S,13S,14S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyrrole-2-carboxylate (PubChem CID 91425434) has the molecular formula C28H32F3NO5S and a molecular weight of 551.63 g/mol. Its IUPAC name is [(8S,10S,13S,14S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [(8S,10S,13S,14S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91425434 |
| Molecular Formula | C28H32F3NO5S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | [(8S,10S,13S,14S)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyrrole-2-carboxylate |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)C3(F)C(O)C[C@]2(C)C1(OC(=O)c1cccn1C)C(=O)SCF |
| InChI | InChI=1S/C28H32F3NO5S/c1-15-10-17-18-12-20(30)19-11-16(33)7-8-25(19,2)27(18,31)22(34)13-26(17,3)28(15,24(36)38-14-29)37-23(35)21-6-5-9-32(21)4/h5-9,11,15,17-18,20,22,34H,10,12-14H2,1-4H3/t15?,17-,18-,20?,22?,25-,26-,27?,28?/m0/s1 |
| InChIKey | ZJSBCYBVFZKQNA-FWYVTBKUSA-N |
| XLogP | 4.67 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|