C28H29N3O6 — CID 91425526
(3S)-3-[acetyl-[2-oxo-6-(2-phenylethyl)-3-(3-phenylpropanoylamino)-1-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 91425526) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is (3S)-3-[acetyl-[2-oxo-6-(2-phenylethyl)-3-(3-phenylpropanoylamino)-1-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[acetyl-[2-oxo-6-(2-phenylethyl)-3-(3-phenylpropanoylamino)-1-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91425526 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (3S)-3-[acetyl-[2-oxo-6-(2-phenylethyl)-3-(3-phenylpropanoylamino)-1-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)N([C@H](C=O)CC(=O)O)n1c(CCc2ccccc2)ccc(NC(=O)CCc2ccccc2)c1=O |
| InChI | InChI=1S/C28H29N3O6/c1-20(33)30(24(19-32)18-27(35)36)31-23(14-12-21-8-4-2-5-9-21)15-16-25(28(31)37)29-26(34)17-13-22-10-6-3-7-11-22/h2-11,15-16,19,24H,12-14,17-18H2,1H3,(H,29,34)(H,35,36)/t24-/m0/s1 |
| InChIKey | AQIZANXYGKMALW-DEOSSOPVSA-N |
| XLogP | 2.73 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|