About 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane
2-tert-butyl-3H-pyrrole;2,2-dimethylpropane (PubChem CID 91425866) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane.
Molecular Properties
| Compound Name | 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane |
| PubChem CID | 91425866 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC(C)(C)C1=NC=CC1 |
| InChI | InChI=1S/C8H13N.C5H12/c1-8(2,3)7-5-4-6-9-7;1-5(2,3)4/h4,6H,5H2,1-3H3;1-4H3 |
| InChIKey | HJIOPAJZRNSQTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane?
The IUPAC name of 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane (CID 91425866) is 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane.
What is the SMILES notation for 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane?
The canonical SMILES for 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane is CC(C)(C)C.CC(C)(C)C1=NC=CC1.
What is the InChIKey of 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane?
The InChIKey is HJIOPAJZRNSQTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C5H12/c1-8(2,3)7-5-4-6-9-7;1-5(2,3)4/h4,6H,5H2,1-3H3;1-4H3.
What are the key properties of 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane?
2-tert-butyl-3H-pyrrole;2,2-dimethylpropane has a molecular weight of 195.35 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3H-pyrrole;2,2-dimethylpropane is sourced from PubChem (CID 91425866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).