C31H34N2O5 — CID 91425936
N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methoxyphenyl)-N-methylprop-2-ynamide (PubChem CID 91425936) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methoxyphenyl)-N-methylprop-2-ynamide.
| Compound Name | N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methoxyphenyl)-N-methylprop-2-ynamide |
|---|---|
| PubChem CID | 91425936 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[(4R,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(3-methoxyphenyl)-N-methylprop-2-ynamide |
| SMILES | COc1cccc(C#CC(=O)N(C)C2CCC3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)C2O6)c1 |
| InChI | InChI=1S/C31H34N2O5/c1-32(26(35)11-8-19-4-3-5-22(16-19)37-2)23-12-13-31(36)25-17-21-9-10-24(34)28-27(21)30(31,29(23)38-28)14-15-33(25)18-20-6-7-20/h3-5,9-10,16,20,23,25,29,34,36H,6-7,12-15,17-18H2,1-2H3/t23?,25-,29?,30+,31?/m1/s1 |
| InChIKey | CPXCAOVQIBVTPI-BSVOTTFZSA-N |
| XLogP | 2.84 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|