C20H26O8S — CID 91425976
(2R,4R,7R,12S)-7,8,16-trihydroxy-18-methoxy-12-methyl-10-methylsulfanyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,14-dione (PubChem CID 91425976) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is (2R,4R,7R,12S)-7,8,16-trihydroxy-18-methoxy-12-methyl-10-methylsulfanyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,14-dione.
| Compound Name | (2R,4R,7R,12S)-7,8,16-trihydroxy-18-methoxy-12-methyl-10-methylsulfanyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,14-dione |
|---|---|
| PubChem CID | 91425976 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (2R,4R,7R,12S)-7,8,16-trihydroxy-18-methoxy-12-methyl-10-methylsulfanyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),16,18-triene-6,14-dione |
| SMILES | COc1cc(O)c2c(c1)[C@H]1O[C@@H]1CC(=O)[C@H](O)C(O)CC(SC)C[C@H](C)OC2=O |
| InChI | InChI=1S/C20H26O8S/c1-9-4-11(29-3)7-14(22)18(24)15(23)8-16-19(28-16)12-5-10(26-2)6-13(21)17(12)20(25)27-9/h5-6,9,11,14,16,18-19,21-22,24H,4,7-8H2,1-3H3/t9-,11?,14?,16+,18+,19+/m0/s1 |
| InChIKey | VVIYGGBDTLIAMV-ZJAREQRLSA-N |
| XLogP | 1.59 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|