C30H43N5O10 — CID 91426384
tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-1,4-dioxobutan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 91426384) has the molecular formula C30H43N5O10 and a molecular weight of 633.70 g/mol. Its IUPAC name is tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-1,4-dioxobutan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-1,4-dioxobutan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 91426384 |
| Molecular Formula | C30H43N5O10 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-1,4-dioxobutan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(CC(=O)NCCCCN1C(=O)C=CC1=O)C(=O)NCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C30H43N5O10/c1-29(2,3)44-27(42)35(28(43)45-30(4,5)6)20(26(41)32-16-8-10-18-34-24(39)13-14-25(34)40)19-21(36)31-15-7-9-17-33-22(37)11-12-23(33)38/h11-14,20H,7-10,15-19H2,1-6H3,(H,31,36)(H,32,41) |
| InChIKey | YHRWEFCHDIMUSF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 188.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|