About methanol;2-methylbutylcyclohexane
methanol;2-methylbutylcyclohexane (PubChem CID 91426413) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is methanol;2-methylbutylcyclohexane.
Molecular Properties
| Compound Name | methanol;2-methylbutylcyclohexane |
| PubChem CID | 91426413 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | methanol;2-methylbutylcyclohexane |
| SMILES | CCC(C)CC1CCCCC1.CO |
| InChI | InChI=1S/C11H22.CH4O/c1-3-10(2)9-11-7-5-4-6-8-11;1-2/h10-11H,3-9H2,1-2H3;2H,1H3 |
| InChIKey | KNJKCZCNPYSYSU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methanol;2-methylbutylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylbutylcyclohexane?
The IUPAC name of methanol;2-methylbutylcyclohexane (CID 91426413) is methanol;2-methylbutylcyclohexane.
What is the SMILES notation for methanol;2-methylbutylcyclohexane?
The canonical SMILES for methanol;2-methylbutylcyclohexane is CCC(C)CC1CCCCC1.CO.
What is the InChIKey of methanol;2-methylbutylcyclohexane?
The InChIKey is KNJKCZCNPYSYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.CH4O/c1-3-10(2)9-11-7-5-4-6-8-11;1-2/h10-11H,3-9H2,1-2H3;2H,1H3.
What are the key properties of methanol;2-methylbutylcyclohexane?
methanol;2-methylbutylcyclohexane has a molecular weight of 186.34 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylbutylcyclohexane is sourced from PubChem (CID 91426413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).