C14H21NO4 — CID 91426547
[(3R,6R)-3-(hex-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91426547) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is [(3R,6R)-3-(hex-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-(hex-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91426547 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [(3R,6R)-3-(hex-4-enoylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC=CCCC(=O)N[C@@H]1C=C[C@H](COC(C)=O)OC1 |
| InChI | InChI=1S/C14H21NO4/c1-3-4-5-6-14(17)15-12-7-8-13(19-9-12)10-18-11(2)16/h3-4,7-8,12-13H,5-6,9-10H2,1-2H3,(H,15,17)/t12-,13-/m1/s1 |
| InChIKey | GMQLWBCXIGNYIR-CHWSQXEVSA-N |
| XLogP | 1.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|