C16H14N2O5 — CID 91427286
2-[(6-isocyano-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid (PubChem CID 91427286) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[(6-isocyano-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(6-isocyano-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 91427286 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[(6-isocyano-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)C(=O)C(C(=O)NCC(=O)O)C2=O |
| InChI | InChI=1S/C16H14N2O5/c1-16(2)10-6-8(17-3)4-5-9(10)13(21)12(14(16)22)15(23)18-7-11(19)20/h4-6,12H,7H2,1-2H3,(H,18,23)(H,19,20) |
| InChIKey | CMZHEOJXYRQUIY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|