C19H26O6S — CID 91427322
11-hydroxy-3,8-dimethyl-12-(2-methylpropylsulfanyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-1(16)-ene-4,14-dione (PubChem CID 91427322) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is 11-hydroxy-3,8-dimethyl-12-(2-methylpropylsulfanyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-1(16)-ene-4,14-dione.
| Compound Name | 11-hydroxy-3,8-dimethyl-12-(2-methylpropylsulfanyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-1(16)-ene-4,14-dione |
|---|---|
| PubChem CID | 91427322 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 11-hydroxy-3,8-dimethyl-12-(2-methylpropylsulfanyl)-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-1(16)-ene-4,14-dione |
| SMILES | CC(C)CSC1C2C=C(OC2=O)C2C(CC3(C)OC3C1O)OC(=O)C2C |
| InChI | InChI=1S/C19H26O6S/c1-8(2)7-26-15-10-5-11(23-18(10)22)13-9(3)17(21)24-12(13)6-19(4)16(25-19)14(15)20/h5,8-10,12-16,20H,6-7H2,1-4H3 |
| InChIKey | CZKHUZCCYZSMEK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|