About 2-methylhexa-1,3-dien-5-yne
2-methylhexa-1,3-dien-5-yne (PubChem CID 91427979) has the molecular formula C7H8
and a molecular weight of 92.14 g/mol. Its IUPAC name is 2-methylhexa-1,3-dien-5-yne.
Molecular Properties
| Compound Name | 2-methylhexa-1,3-dien-5-yne |
| PubChem CID | 91427979 |
| Molecular Formula | C7H8 |
| Molecular Weight | 92.14 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | 2-methylhexa-1,3-dien-5-yne |
| SMILES | C#CC=CC(=C)C |
| InChI | InChI=1S/C7H8/c1-4-5-6-7(2)3/h1,5-6H,2H2,3H3 |
| InChIKey | DDRYBMNQPFYOKF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexa-1,3-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexa-1,3-dien-5-yne?
The IUPAC name of 2-methylhexa-1,3-dien-5-yne (CID 91427979) is 2-methylhexa-1,3-dien-5-yne.
What is the SMILES notation for 2-methylhexa-1,3-dien-5-yne?
The canonical SMILES for 2-methylhexa-1,3-dien-5-yne is C#CC=CC(=C)C.
What is the InChIKey of 2-methylhexa-1,3-dien-5-yne?
The InChIKey is DDRYBMNQPFYOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8/c1-4-5-6-7(2)3/h1,5-6H,2H2,3H3.
What are the key properties of 2-methylhexa-1,3-dien-5-yne?
2-methylhexa-1,3-dien-5-yne has a molecular weight of 92.14 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexa-1,3-dien-5-yne is sourced from PubChem (CID 91427979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).