C20H22O6 — CID 91428060
10-cyclooct-2-en-1-yl-5,13-dioxatricyclo[9.3.0.03,7]tetradec-8-ene-4,6,12,14-tetrone (PubChem CID 91428060) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 10-cyclooct-2-en-1-yl-5,13-dioxatricyclo[9.3.0.03,7]tetradec-8-ene-4,6,12,14-tetrone.
| Compound Name | 10-cyclooct-2-en-1-yl-5,13-dioxatricyclo[9.3.0.03,7]tetradec-8-ene-4,6,12,14-tetrone |
|---|---|
| PubChem CID | 91428060 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 10-cyclooct-2-en-1-yl-5,13-dioxatricyclo[9.3.0.03,7]tetradec-8-ene-4,6,12,14-tetrone |
| SMILES | O=C1OC(=O)C2CC3C(=O)OC(=O)C3C(C3C=CCCCCC3)C=CC12 |
| InChI | InChI=1S/C20H22O6/c21-17-13-9-8-12(11-6-4-2-1-3-5-7-11)16-15(19(23)26-20(16)24)10-14(13)18(22)25-17/h4,6,8-9,11-16H,1-3,5,7,10H2 |
| InChIKey | GGXGQMJCPKEIEP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|