C28H20Cl2F6N2O4 — CID 91428789
3-[1-[5-carbamoyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3,4-dichlorophenyl)propan-2-yl]-1H-indole-7-carboxylic acid (PubChem CID 91428789) has the molecular formula C28H20Cl2F6N2O4 and a molecular weight of 633.37 g/mol. Its IUPAC name is 3-[1-[5-carbamoyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3,4-dichlorophenyl)propan-2-yl]-1H-indole-7-carboxylic acid.
| Compound Name | 3-[1-[5-carbamoyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3,4-dichlorophenyl)propan-2-yl]-1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 91428789 |
| Molecular Formula | C28H20Cl2F6N2O4 |
| Molecular Weight | 633.37 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | 3-[1-[5-carbamoyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3,4-dichlorophenyl)propan-2-yl]-1H-indole-7-carboxylic acid |
| SMILES | CC(Cc1cc(C(N)=O)ccc1C(O)(C(F)(F)F)C(F)(F)F)(c1ccc(Cl)c(Cl)c1)c1c[nH]c2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C28H20Cl2F6N2O4/c1-25(15-6-8-20(29)21(30)10-15,19-12-38-22-16(19)3-2-4-17(22)24(40)41)11-14-9-13(23(37)39)5-7-18(14)26(42,27(31,32)33)28(34,35)36/h2-10,12,38,42H,11H2,1H3,(H2,37,39)(H,40,41) |
| InChIKey | HZFJDTJYAXNTCL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.37 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |