C23H19F3N2O4S — CID 91429176
4-hydroxy-5-[5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-3H-1,3-thiazol-2-one (PubChem CID 91429176) has the molecular formula C23H19F3N2O4S and a molecular weight of 476.48 g/mol. Its IUPAC name is 4-hydroxy-5-[5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91429176 |
| Molecular Formula | C23H19F3N2O4S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-hydroxy-5-[5-[[1-oxo-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-4-yl]oxy]-2,3-dihydro-1H-inden-1-yl]-3H-1,3-thiazol-2-one |
| SMILES | O=C1c2ccccc2C(Oc2ccc3c(c2)CCC3c2sc(=O)[nH]c2O)CN1CC(F)(F)F |
| InChI | InChI=1S/C23H19F3N2O4S/c24-23(25,26)11-28-10-18(15-3-1-2-4-17(15)21(28)30)32-13-6-8-14-12(9-13)5-7-16(14)19-20(29)27-22(31)33-19/h1-4,6,8-9,16,18,29H,5,7,10-11H2,(H,27,31) |
| InChIKey | DEKUBLBQFLIANK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |