C9H12F10O2 — CID 91429246
1,1,2,2,3,3-hexafluoro-1-methoxybutane;1,1,1,2-tetrafluoro-2-methoxypropane (PubChem CID 91429246) has the molecular formula C9H12F10O2 and a molecular weight of 342.17 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-methoxybutane;1,1,1,2-tetrafluoro-2-methoxypropane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-methoxybutane;1,1,1,2-tetrafluoro-2-methoxypropane |
|---|---|
| PubChem CID | 91429246 |
| Molecular Formula | C9H12F10O2 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-methoxybutane;1,1,1,2-tetrafluoro-2-methoxypropane |
| SMILES | COC(C)(F)C(F)(F)F.COC(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C5H6F6O.C4H6F4O/c1-3(6,7)4(8,9)5(10,11)12-2;1-3(5,9-2)4(6,7)8/h1-2H3;1-2H3 |
| InChIKey | ZVRADUYPCSOYNG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|