C16H26O2 — CID 91429553
ethane;4-(2,2,3,3-tetramethylcyclobutyl)oxyphenol (PubChem CID 91429553) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is ethane;4-(2,2,3,3-tetramethylcyclobutyl)oxyphenol.
| Compound Name | ethane;4-(2,2,3,3-tetramethylcyclobutyl)oxyphenol |
|---|---|
| PubChem CID | 91429553 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | ethane;4-(2,2,3,3-tetramethylcyclobutyl)oxyphenol |
| SMILES | CC.CC1(C)CC(Oc2ccc(O)cc2)C1(C)C |
| InChI | InChI=1S/C14H20O2.C2H6/c1-13(2)9-12(14(13,3)4)16-11-7-5-10(15)6-8-11;1-2/h5-8,12,15H,9H2,1-4H3;1-2H3 |
| InChIKey | BLBPBLRITQDWPU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |