C11H8FN5O — CID 91429812
2-(azidomethyl)-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 91429812) has the molecular formula C11H8FN5O and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-(azidomethyl)-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 2-(azidomethyl)-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 91429812 |
| Molecular Formula | C11H8FN5O |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-(azidomethyl)-5-fluoro-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | [N-]=[N+]=NCC1Cc2c(F)cnc3ccc(=O)n1c23 |
| InChI | InChI=1S/C11H8FN5O/c12-8-5-14-9-1-2-10(18)17-6(4-15-16-13)3-7(8)11(9)17/h1-2,5-6H,3-4H2 |
| InChIKey | HPUOJZAIQDJYFM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|