About 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole
1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole (PubChem CID 91430060) has the molecular formula C14H15F2N3
and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole.
Molecular Properties
| Compound Name | 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole |
| PubChem CID | 91430060 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole |
| SMILES | Fc1ccc(C2CCN(Cn3ccnc3)C2)cc1F |
| InChI | InChI=1S/C14H15F2N3/c15-13-2-1-11(7-14(13)16)12-3-5-18(8-12)10-19-6-4-17-9-19/h1-2,4,6-7,9,12H,3,5,8,10H2 |
| InChIKey | NYVBHIRWANZOMJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole?
The IUPAC name of 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole (CID 91430060) is 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole.
What is the SMILES notation for 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole?
The canonical SMILES for 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole is Fc1ccc(C2CCN(Cn3ccnc3)C2)cc1F.
What is the InChIKey of 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole?
The InChIKey is NYVBHIRWANZOMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3/c15-13-2-1-11(7-14(13)16)12-3-5-18(8-12)10-19-6-4-17-9-19/h1-2,4,6-7,9,12H,3,5,8,10H2.
What are the key properties of 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole?
1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole has a molecular weight of 263.29 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(3,4-difluorophenyl)pyrrolidin-1-yl]methyl]imidazole is sourced from PubChem (CID 91430060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).