C19H26ClN3O — CID 91430359
9-(2-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-one (PubChem CID 91430359) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-one.
| Compound Name | 9-(2-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-one |
|---|---|
| PubChem CID | 91430359 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 9-(2-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-one |
| SMILES | CC(C)(C)C(=O)C(CCCCCc1ccccc1Cl)n1cncn1 |
| InChI | InChI=1S/C19H26ClN3O/c1-19(2,3)18(24)17(23-14-21-13-22-23)12-6-4-5-9-15-10-7-8-11-16(15)20/h7-8,10-11,13-14,17H,4-6,9,12H2,1-3H3 |
| InChIKey | PEMKIFQKHRKOEJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|