C28H23N9O8 — CID 91430550
4-[(1R)-2-amino-1-[[5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]phenyl]methylcarbamoyl]-3-oxo-2H-[1,2,4]triazolo[4,3-a]pyrimidine-7-carbonyl]amino]-2-oxoethyl]benzoic acid (PubChem CID 91430550) has the molecular formula C28H23N9O8 and a molecular weight of 613.55 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-[[5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]phenyl]methylcarbamoyl]-3-oxo-2H-[1,2,4]triazolo[4,3-a]pyrimidine-7-carbonyl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[(1R)-2-amino-1-[[5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]phenyl]methylcarbamoyl]-3-oxo-2H-[1,2,4]triazolo[4,3-a]pyrimidine-7-carbonyl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 91430550 |
| Molecular Formula | C28H23N9O8 |
| Molecular Weight | 613.55 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 4-[(1R)-2-amino-1-[[5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]phenyl]methylcarbamoyl]-3-oxo-2H-[1,2,4]triazolo[4,3-a]pyrimidine-7-carbonyl]amino]-2-oxoethyl]benzoic acid |
| SMILES | NC(=O)[C@H](NC(=O)c1cc(C(=O)NCc2cccc(CNc3c(N)c(=O)c3=O)c2)n2c(=O)[nH]nc2n1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H23N9O8/c29-18-20(22(39)21(18)38)31-10-12-2-1-3-13(8-12)11-32-25(42)17-9-16(33-27-35-36-28(45)37(17)27)24(41)34-19(23(30)40)14-4-6-15(7-5-14)26(43)44/h1-9,19,31H,10-11,29H2,(H2,30,40)(H,32,42)(H,34,41)(H,36,45)(H,43,44)/t19-/m1/s1 |
| InChIKey | BMIVONZBKVBQAI-LJQANCHMSA-N |
| XLogP | -1.21 |
| TPSA | 273.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.55 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|