C22H20 — CID 91430696
3,4-dimethyl-3,3a,4,9b-tetrahydroperylene (PubChem CID 91430696) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is 3,4-dimethyl-3,3a,4,9b-tetrahydroperylene.
| Compound Name | 3,4-dimethyl-3,3a,4,9b-tetrahydroperylene |
|---|---|
| PubChem CID | 91430696 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3,4-dimethyl-3,3a,4,9b-tetrahydroperylene |
| SMILES | CC1C=CC2=C3C=CC=C4C=CC=C(C5=C2C1C(C)C=C5)C43 |
| InChI | InChI=1S/C22H20/c1-13-9-11-18-16-7-3-5-15-6-4-8-17(21(15)16)19-12-10-14(2)20(13)22(18)19/h3-14,20-21H,1-2H3 |
| InChIKey | WGDWMHJPSSAGPG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |