About 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one
4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one (PubChem CID 91431200) has the molecular formula C21H36O3
and a molecular weight of 336.52 g/mol. Its IUPAC name is 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one |
| PubChem CID | 91431200 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one |
| SMILES | CCC(C)(OC1CCCCO1)C(C)CCCCCC1C=CC(=O)C1 |
| InChI | InChI=1S/C21H36O3/c1-4-21(3,24-20-12-8-9-15-23-20)17(2)10-6-5-7-11-18-13-14-19(22)16-18/h13-14,17-18,20H,4-12,15-16H2,1-3H3 |
| InChIKey | SQQYIVGBBUDQKJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one?
The IUPAC name of 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one (CID 91431200) is 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one.
What is the SMILES notation for 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one?
The canonical SMILES for 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one is CCC(C)(OC1CCCCO1)C(C)CCCCCC1C=CC(=O)C1.
What is the InChIKey of 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one?
The InChIKey is SQQYIVGBBUDQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O3/c1-4-21(3,24-20-12-8-9-15-23-20)17(2)10-6-5-7-11-18-13-14-19(22)16-18/h13-14,17-18,20H,4-12,15-16H2,1-3H3.
What are the key properties of 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one?
4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one has a molecular weight of 336.52 g/mol, XLogP of 5.43, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6,7-dimethyl-7-(oxan-2-yloxy)nonyl]cyclopent-2-en-1-one is sourced from PubChem (CID 91431200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).