About 7-(diethoxymethyl)undeca-3,7-dienal
7-(diethoxymethyl)undeca-3,7-dienal (PubChem CID 91431448) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 7-(diethoxymethyl)undeca-3,7-dienal.
Molecular Properties
| Compound Name | 7-(diethoxymethyl)undeca-3,7-dienal |
| PubChem CID | 91431448 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 7-(diethoxymethyl)undeca-3,7-dienal |
| SMILES | CCCC=C(CCC=CCC=O)C(OCC)OCC |
| InChI | InChI=1S/C16H28O3/c1-4-7-12-15(13-10-8-9-11-14-17)16(18-5-2)19-6-3/h8-9,12,14,16H,4-7,10-11,13H2,1-3H3 |
| InChIKey | HJAUEKVJNIBLCG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(diethoxymethyl)undeca-3,7-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethoxymethyl)undeca-3,7-dienal?
The IUPAC name of 7-(diethoxymethyl)undeca-3,7-dienal (CID 91431448) is 7-(diethoxymethyl)undeca-3,7-dienal.
What is the SMILES notation for 7-(diethoxymethyl)undeca-3,7-dienal?
The canonical SMILES for 7-(diethoxymethyl)undeca-3,7-dienal is CCCC=C(CCC=CCC=O)C(OCC)OCC.
What is the InChIKey of 7-(diethoxymethyl)undeca-3,7-dienal?
The InChIKey is HJAUEKVJNIBLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-4-7-12-15(13-10-8-9-11-14-17)16(18-5-2)19-6-3/h8-9,12,14,16H,4-7,10-11,13H2,1-3H3.
What are the key properties of 7-(diethoxymethyl)undeca-3,7-dienal?
7-(diethoxymethyl)undeca-3,7-dienal has a molecular weight of 268.40 g/mol, XLogP of 4.04, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethoxymethyl)undeca-3,7-dienal is sourced from PubChem (CID 91431448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).