About 2,2-dimethyl-3H-pyridine
2,2-dimethyl-3H-pyridine (PubChem CID 91431547) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 2,2-dimethyl-3H-pyridine.
Molecular Properties
| Compound Name | 2,2-dimethyl-3H-pyridine |
| PubChem CID | 91431547 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2,2-dimethyl-3H-pyridine |
| SMILES | CC1(C)CC=CC=N1 |
| InChI | InChI=1S/C7H11N/c1-7(2)5-3-4-6-8-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | QAOKLGHVLGANQB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3H-pyridine?
The IUPAC name of 2,2-dimethyl-3H-pyridine (CID 91431547) is 2,2-dimethyl-3H-pyridine.
What is the SMILES notation for 2,2-dimethyl-3H-pyridine?
The canonical SMILES for 2,2-dimethyl-3H-pyridine is CC1(C)CC=CC=N1.
What is the InChIKey of 2,2-dimethyl-3H-pyridine?
The InChIKey is QAOKLGHVLGANQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-7(2)5-3-4-6-8-7/h3-4,6H,5H2,1-2H3.
What are the key properties of 2,2-dimethyl-3H-pyridine?
2,2-dimethyl-3H-pyridine has a molecular weight of 109.17 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3H-pyridine is sourced from PubChem (CID 91431547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).