About ethane;1-ethyl-3H-pyridine-2,6-dione
ethane;1-ethyl-3H-pyridine-2,6-dione (PubChem CID 91431564) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is ethane;1-ethyl-3H-pyridine-2,6-dione.
Molecular Properties
| Compound Name | ethane;1-ethyl-3H-pyridine-2,6-dione |
| PubChem CID | 91431564 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | ethane;1-ethyl-3H-pyridine-2,6-dione |
| SMILES | CC.CCN1C(=O)C=CCC1=O |
| InChI | InChI=1S/C7H9NO2.C2H6/c1-2-8-6(9)4-3-5-7(8)10;1-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | OYQDMNMUDWVUTO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-3H-pyridine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3H-pyridine-2,6-dione?
The IUPAC name of ethane;1-ethyl-3H-pyridine-2,6-dione (CID 91431564) is ethane;1-ethyl-3H-pyridine-2,6-dione.
What is the SMILES notation for ethane;1-ethyl-3H-pyridine-2,6-dione?
The canonical SMILES for ethane;1-ethyl-3H-pyridine-2,6-dione is CC.CCN1C(=O)C=CCC1=O.
What is the InChIKey of ethane;1-ethyl-3H-pyridine-2,6-dione?
The InChIKey is OYQDMNMUDWVUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C2H6/c1-2-8-6(9)4-3-5-7(8)10;1-2/h3-4H,2,5H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-3H-pyridine-2,6-dione?
ethane;1-ethyl-3H-pyridine-2,6-dione has a molecular weight of 169.22 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3H-pyridine-2,6-dione is sourced from PubChem (CID 91431564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).