C6H9F3N3+ — CID 91431739
1,4,5-trimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium (PubChem CID 91431739) has the molecular formula C6H9F3N3+ and a molecular weight of 180.15 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium.
| Compound Name | 1,4,5-trimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 91431739 |
| Molecular Formula | C6H9F3N3+ |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1,4,5-trimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium |
| SMILES | Cc1n(C)nc(C(F)(F)F)[n+]1C |
| InChI | InChI=1S/C6H9F3N3/c1-4-11(2)5(6(7,8)9)10-12(4)3/h1-3H3/q+1 |
| InChIKey | DJGGLWKWITYNIN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|