About 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine
4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine (PubChem CID 914319) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine |
| PubChem CID | 914319 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine |
| SMILES | C=C(C)[C@@H]1CC[C@H](C)O[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C14H25NO2/c1-11(2)13-5-4-12(3)17-14(13)10-15-6-8-16-9-7-15/h12-14H,1,4-10H2,2-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | MICUGXWKYVNMTG-IHRRRGAJSA-N |
| XLogP | 2.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine?
The IUPAC name of 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine (CID 914319) is 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine is C=C(C)[C@@H]1CC[C@H](C)O[C@H]1CN1CCOCC1.
What is the InChIKey of 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine?
The InChIKey is MICUGXWKYVNMTG-IHRRRGAJSA-N. The full InChI is InChI=1S/C14H25NO2/c1-11(2)13-5-4-12(3)17-14(13)10-15-6-8-16-9-7-15/h12-14H,1,4-10H2,2-3H3/t12-,13-,14-/m0/s1.
What are the key properties of 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine?
4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine has a molecular weight of 239.36 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,3S,6S)-6-methyl-3-prop-1-en-2-yloxan-2-yl]methyl]morpholine is sourced from PubChem (CID 914319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).