C22H19F6NO2 — CID 91432028
(6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenyl-1,3-dihydropyridin-2-one (PubChem CID 91432028) has the molecular formula C22H19F6NO2 and a molecular weight of 443.39 g/mol. Its IUPAC name is (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenyl-1,3-dihydropyridin-2-one.
| Compound Name | (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenyl-1,3-dihydropyridin-2-one |
|---|---|
| PubChem CID | 91432028 |
| Molecular Formula | C22H19F6NO2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenyl-1,3-dihydropyridin-2-one |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)C=CCC(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F6NO2/c1-14(15-10-17(21(23,24)25)12-18(11-15)22(26,27)28)31-13-20(9-5-8-19(30)29-20)16-6-3-2-4-7-16/h2-7,9-12,14H,8,13H2,1H3,(H,29,30)/t14-,20-/m1/s1 |
| InChIKey | XEZLKPAXTGQNBY-JLTOFOAXSA-N |
| XLogP | 5.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|