About but-3-en-2-yl 2-aminoacetate
but-3-en-2-yl 2-aminoacetate (PubChem CID 91432114) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is but-3-en-2-yl 2-aminoacetate.
Molecular Properties
| Compound Name | but-3-en-2-yl 2-aminoacetate |
| PubChem CID | 91432114 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | but-3-en-2-yl 2-aminoacetate |
| SMILES | C=CC(C)OC(=O)CN |
| InChI | InChI=1S/C6H11NO2/c1-3-5(2)9-6(8)4-7/h3,5H,1,4,7H2,2H3 |
| InChIKey | HDDRBPPCOHEGEA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yl 2-aminoacetate?
The IUPAC name of but-3-en-2-yl 2-aminoacetate (CID 91432114) is but-3-en-2-yl 2-aminoacetate.
What is the SMILES notation for but-3-en-2-yl 2-aminoacetate?
The canonical SMILES for but-3-en-2-yl 2-aminoacetate is C=CC(C)OC(=O)CN.
What is the InChIKey of but-3-en-2-yl 2-aminoacetate?
The InChIKey is HDDRBPPCOHEGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-5(2)9-6(8)4-7/h3,5H,1,4,7H2,2H3.
What are the key properties of but-3-en-2-yl 2-aminoacetate?
but-3-en-2-yl 2-aminoacetate has a molecular weight of 129.16 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yl 2-aminoacetate is sourced from PubChem (CID 91432114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).