C9H5Cl2F5O — CID 91432208
1,3-dichloro-5-(2,2,3,3,3-pentafluoropropoxy)benzene (PubChem CID 91432208) has the molecular formula C9H5Cl2F5O and a molecular weight of 295.03 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,2,3,3,3-pentafluoropropoxy)benzene.
| Compound Name | 1,3-dichloro-5-(2,2,3,3,3-pentafluoropropoxy)benzene |
|---|---|
| PubChem CID | 91432208 |
| Molecular Formula | C9H5Cl2F5O |
| Molecular Weight | 295.03 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 1,3-dichloro-5-(2,2,3,3,3-pentafluoropropoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2F5O/c10-5-1-6(11)3-7(2-5)17-4-8(12,13)9(14,15)16/h1-3H,4H2 |
| InChIKey | MMHLLQSOEUASIU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|