About 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one
3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 91432228) has the molecular formula C18H17F3N2O4
and a molecular weight of 382.34 g/mol. Its IUPAC name is 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| PubChem CID | 91432228 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | CCc1cc(-n2c(=O)[nH]c3c(O)c(C(F)(F)F)ccc32)c(OC)cc1OC |
| InChI | InChI=1S/C18H17F3N2O4/c1-4-9-7-12(14(27-3)8-13(9)26-2)23-11-6-5-10(18(19,20)21)16(24)15(11)22-17(23)25/h5-8,24H,4H2,1-3H3,(H,22,25) |
| InChIKey | SJBIRJNZSYFQQA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one?
The IUPAC name of 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one (CID 91432228) is 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one.
What is the SMILES notation for 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one?
The canonical SMILES for 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one is CCc1cc(-n2c(=O)[nH]c3c(O)c(C(F)(F)F)ccc32)c(OC)cc1OC.
What is the InChIKey of 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one?
The InChIKey is SJBIRJNZSYFQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N2O4/c1-4-9-7-12(14(27-3)8-13(9)26-2)23-11-6-5-10(18(19,20)21)16(24)15(11)22-17(23)25/h5-8,24H,4H2,1-3H3,(H,22,25).
What are the key properties of 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one?
3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one has a molecular weight of 382.34 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-2,4-dimethoxyphenyl)-7-hydroxy-6-(trifluoromethyl)-1H-benzimidazol-2-one is sourced from PubChem (CID 91432228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).