About 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide
3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide (PubChem CID 91432403) has the molecular formula C15H21N5O6
and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide.
Molecular Properties
| Compound Name | 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide |
| PubChem CID | 91432403 |
| Molecular Formula | C15H21N5O6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide |
| SMILES | CNC(=O)CC(CC(=O)NCNC(=O)CN1C(=O)C=CC1=O)NC(C)=O |
| InChI | InChI=1S/C15H21N5O6/c1-9(21)19-10(5-11(22)16-2)6-12(23)17-8-18-13(24)7-20-14(25)3-4-15(20)26/h3-4,10H,5-8H2,1-2H3,(H,16,22)(H,17,23)(H,18,24)(H,19,21) |
| InChIKey | SJJNIJLQGPVGAD-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide?
The IUPAC name of 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide (CID 91432403) is 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide.
What is the SMILES notation for 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide?
The canonical SMILES for 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide is CNC(=O)CC(CC(=O)NCNC(=O)CN1C(=O)C=CC1=O)NC(C)=O.
What is the InChIKey of 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide?
The InChIKey is SJJNIJLQGPVGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O6/c1-9(21)19-10(5-11(22)16-2)6-12(23)17-8-18-13(24)7-20-14(25)3-4-15(20)26/h3-4,10H,5-8H2,1-2H3,(H,16,22)(H,17,23)(H,18,24)(H,19,21).
What are the key properties of 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide?
3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide has a molecular weight of 367.36 g/mol, XLogP of -2.87, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide is sourced from PubChem (CID 91432403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).