C32H29FN4O2 — CID 91432606
N-[(1R,2R)-6-[[2-(benzimidazol-1-yl)ethylamino]methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide (PubChem CID 91432606) has the molecular formula C32H29FN4O2 and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[(1R,2R)-6-[[2-(benzimidazol-1-yl)ethylamino]methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide.
| Compound Name | N-[(1R,2R)-6-[[2-(benzimidazol-1-yl)ethylamino]methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
|---|---|
| PubChem CID | 91432606 |
| Molecular Formula | C32H29FN4O2 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[(1R,2R)-6-[[2-(benzimidazol-1-yl)ethylamino]methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
| SMILES | O=C(N[C@@H]1c2cc(CNCCn3cnc4ccccc43)ccc2C[C@H]1O)c1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C32H29FN4O2/c33-27-17-23(22-6-2-1-3-7-22)12-13-25(27)32(39)36-31-26-16-21(10-11-24(26)18-30(31)38)19-34-14-15-37-20-35-28-8-4-5-9-29(28)37/h1-13,16-17,20,30-31,34,38H,14-15,18-19H2,(H,36,39)/t30-,31-/m1/s1 |
| InChIKey | WEAGAHNBDXZQBP-FIRIVFDPSA-N |
| XLogP | 5.02 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|