C10H12F6N2O — CID 91432816
benzene-1,3-diamine;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol (PubChem CID 91432816) has the molecular formula C10H12F6N2O and a molecular weight of 290.21 g/mol. Its IUPAC name is benzene-1,3-diamine;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol.
| Compound Name | benzene-1,3-diamine;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 91432816 |
| Molecular Formula | C10H12F6N2O |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | benzene-1,3-diamine;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)F.Nc1cccc(N)c1 |
| InChI | InChI=1S/C6H8N2.C4H4F6O/c7-5-2-1-3-6(8)4-5;1-2(11,3(5,6)7)4(8,9)10/h1-4H,7-8H2;11H,1H3 |
| InChIKey | ITNFBLZKJCUVEK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|