C16H17ClN4 — CID 91433173
4-(6-chlorocyclohexa-1,3-dien-1-yl)-5-isocyano-6-propan-2-yl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 91433173) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-(6-chlorocyclohexa-1,3-dien-1-yl)-5-isocyano-6-propan-2-yl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(6-chlorocyclohexa-1,3-dien-1-yl)-5-isocyano-6-propan-2-yl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 91433173 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-(6-chlorocyclohexa-1,3-dien-1-yl)-5-isocyano-6-propan-2-yl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(C(C)C)=Nc2[nH]ncc2C1C1=CC=CCC1Cl |
| InChI | InChI=1S/C16H17ClN4/c1-9(2)14-15(18-3)13(10-6-4-5-7-12(10)17)11-8-19-21-16(11)20-14/h4-6,8-9,12-13,15H,7H2,1-2H3,(H,19,21) |
| InChIKey | XZQHWHYZSVDBDX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|