About 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid
6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid (PubChem CID 91433500) has the molecular formula C11H17N2O2+
and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid |
| PubChem CID | 91433500 |
| Molecular Formula | C11H17N2O2+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCC[C+]1N=CC=N1)C(=O)O |
| InChI | InChI=1S/C11H16N2O2/c1-11(2,10(14)15)6-4-3-5-9-12-7-8-13-9/h7-8H,3-6H2,1-2H3/p+1 |
| InChIKey | LIDPITIBDMNIQR-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid?
The IUPAC name of 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid (CID 91433500) is 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid.
What is the SMILES notation for 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid?
The canonical SMILES for 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid is CC(C)(CCCC[C+]1N=CC=N1)C(=O)O.
What is the InChIKey of 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid?
The InChIKey is LIDPITIBDMNIQR-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H16N2O2/c1-11(2,10(14)15)6-4-3-5-9-12-7-8-13-9/h7-8H,3-6H2,1-2H3/p+1.
What are the key properties of 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid?
6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid has a molecular weight of 209.27 g/mol, XLogP of 2.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imidazol-2-ylium-2-yl-2,2-dimethylhexanoic acid is sourced from PubChem (CID 91433500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).