C26H22F20O2 — CID 91433541
2-[3-butan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decane (PubChem CID 91433541) has the molecular formula C26H22F20O2 and a molecular weight of 746.42 g/mol. Its IUPAC name is 2-[3-butan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decane.
| Compound Name | 2-[3-butan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 91433541 |
| Molecular Formula | C26H22F20O2 |
| Molecular Weight | 746.42 g/mol |
| Exact Mass | 746.13 |
| IUPAC Name | 2-[3-butan-2-yl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decane |
| SMILES | CCC(C)c1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1.FC1(F)C(F)(F)C2(F)C3CCC(C3)C2(F)C1(F)F |
| InChI | InChI=1S/C16H14F12O2.C10H8F8/c1-3-7(2)8-4-9(11(29,13(17,18)19)14(20,21)22)6-10(5-8)12(30,15(23,24)25)16(26,27)28;11-6-4-1-2-5(3-4)7(6,12)9(15,16)10(17,18)8(6,13)14/h4-7,29-30H,3H2,1-2H3;4-5H,1-3H2 |
| InChIKey | IRTPYCKQERYZEW-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.42 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|