About 2-chloro-4-cyclopropyl-1,3-oxazole
2-chloro-4-cyclopropyl-1,3-oxazole (PubChem CID 91433552) has the molecular formula C6H6ClNO
and a molecular weight of 143.57 g/mol. Its IUPAC name is 2-chloro-4-cyclopropyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-chloro-4-cyclopropyl-1,3-oxazole |
| PubChem CID | 91433552 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | 2-chloro-4-cyclopropyl-1,3-oxazole |
| SMILES | Clc1nc(C2CC2)co1 |
| InChI | InChI=1S/C6H6ClNO/c7-6-8-5(3-9-6)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | HFDVPIIWRWVMRN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-cyclopropyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-cyclopropyl-1,3-oxazole?
The IUPAC name of 2-chloro-4-cyclopropyl-1,3-oxazole (CID 91433552) is 2-chloro-4-cyclopropyl-1,3-oxazole.
What is the SMILES notation for 2-chloro-4-cyclopropyl-1,3-oxazole?
The canonical SMILES for 2-chloro-4-cyclopropyl-1,3-oxazole is Clc1nc(C2CC2)co1.
What is the InChIKey of 2-chloro-4-cyclopropyl-1,3-oxazole?
The InChIKey is HFDVPIIWRWVMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO/c7-6-8-5(3-9-6)4-1-2-4/h3-4H,1-2H2.
What are the key properties of 2-chloro-4-cyclopropyl-1,3-oxazole?
2-chloro-4-cyclopropyl-1,3-oxazole has a molecular weight of 143.57 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-cyclopropyl-1,3-oxazole is sourced from PubChem (CID 91433552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).