C22H21BrN6O5S2 — CID 91433710
5-(4-bromophenyl)-4-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine (PubChem CID 91433710) has the molecular formula C22H21BrN6O5S2 and a molecular weight of 593.49 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine.
| Compound Name | 5-(4-bromophenyl)-4-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine |
|---|---|
| PubChem CID | 91433710 |
| Molecular Formula | C22H21BrN6O5S2 |
| Molecular Weight | 593.49 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | 5-(4-bromophenyl)-4-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-6-[[methyl(thiophen-2-yl)sulfamoyl]amino]pyrimidine |
| SMILES | COc1cnc(OCCOc2ncnc(NS(=O)(=O)N(C)c3cccs3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C22H21BrN6O5S2/c1-29(18-4-3-11-35-18)36(30,31)28-20-19(15-5-7-16(23)8-6-15)21(27-14-26-20)33-9-10-34-22-24-12-17(32-2)13-25-22/h3-8,11-14H,9-10H2,1-2H3,(H,26,27,28) |
| InChIKey | GRMNNBBUDDGUJW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|