C14H15ClF3N3O — CID 91433762
2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]pentanamide (PubChem CID 91433762) has the molecular formula C14H15ClF3N3O and a molecular weight of 333.74 g/mol. Its IUPAC name is 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]pentanamide.
| Compound Name | 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]pentanamide |
|---|---|
| PubChem CID | 91433762 |
| Molecular Formula | C14H15ClF3N3O |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[3-chloro-4-cyano-N-(2,2,2-trifluoroethyl)anilino]pentanamide |
| SMILES | CCCC(C(N)=O)N(CC(F)(F)F)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClF3N3O/c1-2-3-12(13(20)22)21(8-14(16,17)18)10-5-4-9(7-19)11(15)6-10/h4-6,12H,2-3,8H2,1H3,(H2,20,22) |
| InChIKey | PHTRFLXUHZHVIC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |