C26H38O3 — CID 91433766
trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2S)-1-but-2-ynoxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 91433766) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2S)-1-but-2-ynoxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2S)-1-but-2-ynoxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91433766 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2S)-1-but-2-ynoxypropan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)COCC#CC)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H38O3/c1-5-6-14-29-17-18(2)23-11-12-24-20(8-7-13-26(23,24)4)9-10-21-15-22(27)16-25(28)19(21)3/h9-10,18,22-25,27-28H,3,7-8,11-17H2,1-2,4H3/t18-,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | XFLPWPWTGPQWNW-YCNLZJMHSA-N |
| XLogP | 4.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|