C11H16F3N — CID 91433918
8-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline (PubChem CID 91433918) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is 8-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline.
| Compound Name | 8-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline |
|---|---|
| PubChem CID | 91433918 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 8-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,6,7,8a-octahydro-1H-quinoline |
| SMILES | C=C1CCCC2CCC(C(F)(F)F)NC12 |
| InChI | InChI=1S/C11H16F3N/c1-7-3-2-4-8-5-6-9(11(12,13)14)15-10(7)8/h8-10,15H,1-6H2 |
| InChIKey | MRKUCTCCXBVEDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|