About 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal
10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal (PubChem CID 91434846) has the molecular formula C20H36O3
and a molecular weight of 324.50 g/mol. Its IUPAC name is 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal.
Molecular Properties
| Compound Name | 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal |
| PubChem CID | 91434846 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal |
| SMILES | CCCCCCCC1(CCCCCCCC=CC=O)OCCO1 |
| InChI | InChI=1S/C20H36O3/c1-2-3-4-9-12-15-20(22-18-19-23-20)16-13-10-7-5-6-8-11-14-17-21/h11,14,17H,2-10,12-13,15-16,18-19H2,1H3 |
| InChIKey | GJQWPZLGUVQVKR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal?
The IUPAC name of 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal (CID 91434846) is 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal.
What is the SMILES notation for 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal?
The canonical SMILES for 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal is CCCCCCCC1(CCCCCCCC=CC=O)OCCO1.
What is the InChIKey of 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal?
The InChIKey is GJQWPZLGUVQVKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O3/c1-2-3-4-9-12-15-20(22-18-19-23-20)16-13-10-7-5-6-8-11-14-17-21/h11,14,17H,2-10,12-13,15-16,18-19H2,1H3.
What are the key properties of 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal?
10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal has a molecular weight of 324.50 g/mol, XLogP of 5.58, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-heptyl-1,3-dioxolan-2-yl)dec-2-enal is sourced from PubChem (CID 91434846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).