C30H40F7NO5S — CID 91435040
[(13S,17S)-8-(10,10,11,11,12,12,12-heptafluoro-9-hydroxydodec-1-enyl)-17-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 91435040) has the molecular formula C30H40F7NO5S and a molecular weight of 659.70 g/mol. Its IUPAC name is [(13S,17S)-8-(10,10,11,11,12,12,12-heptafluoro-9-hydroxydodec-1-enyl)-17-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(13S,17S)-8-(10,10,11,11,12,12,12-heptafluoro-9-hydroxydodec-1-enyl)-17-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 91435040 |
| Molecular Formula | C30H40F7NO5S |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | [(13S,17S)-8-(10,10,11,11,12,12,12-heptafluoro-9-hydroxydodec-1-enyl)-17-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C[C@]12CCC3c4ccc(NS(=O)(=O)O)cc4CCC3(C=CCCCCCCC(O)C(F)(F)C(F)(F)C(F)(F)F)C1CC[C@@H]2O |
| InChI | InChI=1S/C30H40F7NO5S/c1-26-16-14-22-21-10-9-20(38-44(41,42)43)18-19(21)13-17-27(22,23(26)11-12-24(26)39)15-7-5-3-2-4-6-8-25(40)28(31,32)29(33,34)30(35,36)37/h7,9-10,15,18,22-25,38-40H,2-6,8,11-14,16-17H2,1H3,(H,41,42,43)/t22?,23?,24-,25?,26-,27?/m0/s1 |
| InChIKey | XCJXFMZOAKPORC-ZBPZGGJXSA-N |
| XLogP | 7.58 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|