C20H40N4O8+4 — CID 91435369
2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetramethyl-1,4,7,10-tetrazoniacyclododec-1-yl]acetic acid (PubChem CID 91435369) has the molecular formula C20H40N4O8+4 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetramethyl-1,4,7,10-tetrazoniacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetramethyl-1,4,7,10-tetrazoniacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 91435369 |
| Molecular Formula | C20H40N4O8+4 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetramethyl-1,4,7,10-tetrazoniacyclododec-1-yl]acetic acid |
| SMILES | C[N+]1(CC(=O)O)CC[N+](C)(CC(=O)O)CC[N+](C)(CC(=O)O)CC[N+](C)(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H36N4O8/c1-21(13-17(25)26)5-7-22(2,14-18(27)28)9-11-24(4,16-20(31)32)12-10-23(3,8-6-21)15-19(29)30/h5-16H2,1-4H3/p+4 |
| InChIKey | IWWPUWAKWVKSEX-UHFFFAOYSA-R |
| XLogP | -1.88 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|