C17H17FN4O — CID 91435470
(4S)-2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-1,4-dimethyl-4,5-dihydropyrimidin-6-one (PubChem CID 91435470) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is (4S)-2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-1,4-dimethyl-4,5-dihydropyrimidin-6-one.
| Compound Name | (4S)-2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-1,4-dimethyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 91435470 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (4S)-2-amino-5-[3-(2-fluoro-3-pyridinyl)phenyl]-1,4-dimethyl-4,5-dihydropyrimidin-6-one |
| SMILES | C[C@@H]1N=C(N)N(C)C(=O)C1c1cccc(-c2cccnc2F)c1 |
| InChI | InChI=1S/C17H17FN4O/c1-10-14(16(23)22(2)17(19)21-10)12-6-3-5-11(9-12)13-7-4-8-20-15(13)18/h3-10,14H,1-2H3,(H2,19,21)/t10-,14?/m0/s1 |
| InChIKey | DOEDWYCLBJSZAI-XLLULAGJSA-N |
| XLogP | 2.15 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|