About 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one
1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one (PubChem CID 91435698) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one.
Analyze 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one?
The IUPAC name of 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one (CID 91435698) is 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one.
What is the SMILES notation for 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one?
The canonical SMILES for 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one is O=c1ccnc2n1C=C2.
What is the InChIKey of 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one?
The InChIKey is LGRWSRWYXFFETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c9-6-1-3-7-5-2-4-8(5)6/h1-4H.
What are the key properties of 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one?
1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one has a molecular weight of 120.11 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diazabicyclo[4.2.0]octa-3,5,7-trien-2-one is sourced from PubChem (CID 91435698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).