C16H23N3O6S — CID 91435813
tert-butyl N-[3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]propyl]carbamate (PubChem CID 91435813) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is tert-butyl N-[3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 91435813 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | tert-butyl N-[3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(N2C=C(O)NS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C16H23N3O6S/c1-16(2,3)25-15(22)17-8-4-5-11-6-7-12(13(20)9-11)19-10-14(21)18-26(19,23)24/h6-7,9-10,18,20-21H,4-5,8H2,1-3H3,(H,17,22) |
| InChIKey | JJTDYYNSWZDVGW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|