C21H27N5O5 — CID 91436234
8-(cyclopentylamino)-7-methyl-10-(3,4,5-trihydroxypentyl)benzo[g]pteridine-2,4-dione (PubChem CID 91436234) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 8-(cyclopentylamino)-7-methyl-10-(3,4,5-trihydroxypentyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 8-(cyclopentylamino)-7-methyl-10-(3,4,5-trihydroxypentyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91436234 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 8-(cyclopentylamino)-7-methyl-10-(3,4,5-trihydroxypentyl)benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCC(O)C(O)CO)c2cc1NC1CCCC1 |
| InChI | InChI=1S/C21H27N5O5/c1-11-8-14-15(9-13(11)22-12-4-2-3-5-12)26(7-6-16(28)17(29)10-27)19-18(23-14)20(30)25-21(31)24-19/h8-9,12,16-17,22,27-29H,2-7,10H2,1H3,(H,25,30,31) |
| InChIKey | KNLRQJHMWAXQHC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|