About 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol
5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol (PubChem CID 91436386) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol.
Molecular Properties
| Compound Name | 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol |
| PubChem CID | 91436386 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol |
| SMILES | [N-]=[N+]=C1COCCc2c1c(O)c1ccccc1c2O |
| InChI | InChI=1S/C14H12N2O3/c15-16-11-7-19-6-5-10-12(11)14(18)9-4-2-1-3-8(9)13(10)17/h1-4,17-18H,5-7H2 |
| InChIKey | UNUBNANOKJYSRA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol?
The IUPAC name of 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol (CID 91436386) is 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol.
What is the SMILES notation for 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol?
The canonical SMILES for 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol is [N-]=[N+]=C1COCCc2c1c(O)c1ccccc1c2O.
What is the InChIKey of 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol?
The InChIKey is UNUBNANOKJYSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c15-16-11-7-19-6-5-10-12(11)14(18)9-4-2-1-3-8(9)13(10)17/h1-4,17-18H,5-7H2.
What are the key properties of 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol?
5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol has a molecular weight of 256.26 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazo-1,2-dihydrobenzo[h][3]benzoxepine-6,11-diol is sourced from PubChem (CID 91436386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).